C17H28N2OS — CID 769521
(1S,8R)-N-(tert-butylcarbamothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide (PubChem CID 769521) has the molecular formula C17H28N2OS and a molecular weight of 308.49 g/mol. Its IUPAC name is (1S,8R)-N-(tert-butylcarbamothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide.
| Compound Name | (1S,8R)-N-(tert-butylcarbamothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
|---|---|
| PubChem CID | 769521 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (1S,8R)-N-(tert-butylcarbamothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
| SMILES | CC(C)(C)NC(=S)NC(=O)C12CCC3C[C@H](C[C@H](C3)C1)C2 |
| InChI | InChI=1S/C17H28N2OS/c1-16(2,3)19-15(21)18-14(20)17-5-4-11-6-12(9-17)8-13(7-11)10-17/h11-13H,4-10H2,1-3H3,(H2,18,19,20,21)/t11?,12-,13+,17? |
| InChIKey | GSJKSAXRWCGEOK-GIIQZNHOSA-N |
| XLogP | 3.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|