C9H12N6OS2 — CID 76952233
N'-hydroxy-1,3-dimethyl-5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazole-4-carboximidamide (PubChem CID 76952233) has the molecular formula C9H12N6OS2 and a molecular weight of 284.37 g/mol. Its IUPAC name is N'-hydroxy-1,3-dimethyl-5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazole-4-carboximidamide.
| Compound Name | N'-hydroxy-1,3-dimethyl-5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952233 |
| Molecular Formula | C9H12N6OS2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N'-hydroxy-1,3-dimethyl-5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazole-4-carboximidamide |
| SMILES | Cc1nnc(Sc2c(C(N)=NO)c(C)nn2C)s1 |
| InChI | InChI=1S/C9H12N6OS2/c1-4-6(7(10)14-16)8(15(3)13-4)18-9-12-11-5(2)17-9/h16H,1-3H3,(H2,10,14) |
| InChIKey | OULSSOLDDVCYEL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|