About 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide
5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 76952318) has the molecular formula C12H12Cl2N4OS
and a molecular weight of 331.23 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 76952318 |
| Molecular Formula | C12H12Cl2N4OS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | Cc1nn(C)c(Sc2cc(Cl)ccc2Cl)c1C(N)=NO |
| InChI | InChI=1S/C12H12Cl2N4OS/c1-6-10(11(15)17-19)12(18(2)16-6)20-9-5-7(13)3-4-8(9)14/h3-5,19H,1-2H3,(H2,15,17) |
| InChIKey | MKHRFYCXHZVSNC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (CID 76952318) is 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is Cc1nn(C)c(Sc2cc(Cl)ccc2Cl)c1C(N)=NO.
What is the InChIKey of 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is MKHRFYCXHZVSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N4OS/c1-6-10(11(15)17-19)12(18(2)16-6)20-9-5-7(13)3-4-8(9)14/h3-5,19H,1-2H3,(H2,15,17).
What are the key properties of 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 331.23 g/mol, XLogP of 3.28, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dichlorophenyl)sulfanyl-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 76952318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).