C14H26N6O — CID 76952340
N'-hydroxy-1,3-dimethyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pyrazole-4-carboximidamide (PubChem CID 76952340) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is N'-hydroxy-1,3-dimethyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pyrazole-4-carboximidamide.
| Compound Name | N'-hydroxy-1,3-dimethyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 76952340 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | N'-hydroxy-1,3-dimethyl-5-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]pyrazole-4-carboximidamide |
| SMILES | Cc1nn(C)c(N(C)CC2CCN(C)CC2)c1C(N)=NO |
| InChI | InChI=1S/C14H26N6O/c1-10-12(13(15)17-21)14(20(4)16-10)19(3)9-11-5-7-18(2)8-6-11/h11,21H,5-9H2,1-4H3,(H2,15,17) |
| InChIKey | KZLRQVQBKSCTJW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|