C10H12F3N3O3S — CID 76952828
N'-hydroxy-4-[(2,4,6-trifluorophenyl)sulfonylamino]butanimidamide (PubChem CID 76952828) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is N'-hydroxy-4-[(2,4,6-trifluorophenyl)sulfonylamino]butanimidamide.
| Compound Name | N'-hydroxy-4-[(2,4,6-trifluorophenyl)sulfonylamino]butanimidamide |
|---|---|
| PubChem CID | 76952828 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N'-hydroxy-4-[(2,4,6-trifluorophenyl)sulfonylamino]butanimidamide |
| SMILES | NC(CCCNS(=O)(=O)c1c(F)cc(F)cc1F)=NO |
| InChI | InChI=1S/C10H12F3N3O3S/c11-6-4-7(12)10(8(13)5-6)20(18,19)15-3-1-2-9(14)16-17/h4-5,15,17H,1-3H2,(H2,14,16) |
| InChIKey | DKENYJAFDIXBHD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|