C7H12F3N3O2 — CID 76952967
N-(3-amino-3-hydroxyimino-2-methylpropyl)-3,3,3-trifluoropropanamide (PubChem CID 76952967) has the molecular formula C7H12F3N3O2 and a molecular weight of 227.19 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyimino-2-methylpropyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(3-amino-3-hydroxyimino-2-methylpropyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 76952967 |
| Molecular Formula | C7H12F3N3O2 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-(3-amino-3-hydroxyimino-2-methylpropyl)-3,3,3-trifluoropropanamide |
| SMILES | CC(CNC(=O)CC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C7H12F3N3O2/c1-4(6(11)13-15)3-12-5(14)2-7(8,9)10/h4,15H,2-3H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | GLZDUEHPDYVLHJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|