C11H13N4O6- — CID 7695412
(2S)-4-amino-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]-4-oxobutanoate (PubChem CID 7695412) has the molecular formula C11H13N4O6- and a molecular weight of 297.25 g/mol. Its IUPAC name is (2S)-4-amino-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]-4-oxobutanoate.
| Compound Name | (2S)-4-amino-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7695412 |
| Molecular Formula | C11H13N4O6- |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2S)-4-amino-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]-4-oxobutanoate |
| SMILES | CN1C(=O)C(/C=N/[C@@H](CC(N)=O)C(=O)[O-])C(=O)N(C)C1=O |
| InChI | InChI=1S/C11H14N4O6/c1-14-8(17)5(9(18)15(2)11(14)21)4-13-6(10(19)20)3-7(12)16/h4-6H,3H2,1-2H3,(H2,12,16)(H,19,20)/p-1/b13-4+/t6-/m0/s1 |
| InChIKey | KBZCLYVTAHYJCS-MBLXYFMPSA-M |
| XLogP | -3.28 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|