C8H16N4O2 — CID 76954547
1-(1-amino-1-hydroxyiminobutan-2-yl)-3-cyclopropylurea (PubChem CID 76954547) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(1-amino-1-hydroxyiminobutan-2-yl)-3-cyclopropylurea.
| Compound Name | 1-(1-amino-1-hydroxyiminobutan-2-yl)-3-cyclopropylurea |
|---|---|
| PubChem CID | 76954547 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(1-amino-1-hydroxyiminobutan-2-yl)-3-cyclopropylurea |
| SMILES | CCC(NC(=O)NC1CC1)C(N)=NO |
| InChI | InChI=1S/C8H16N4O2/c1-2-6(7(9)12-14)11-8(13)10-5-3-4-5/h5-6,14H,2-4H2,1H3,(H2,9,12)(H2,10,11,13) |
| InChIKey | FLMHTPVQMAWXSY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|