About [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate (PubChem CID 7695467) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate |
| PubChem CID | 7695467 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H26N2O4/c1-2-3-19-17(23)20-15(21)11-24-16(22)10-18-7-12-4-13(8-18)6-14(5-12)9-18/h2,12-14H,1,3-11H2,(H2,19,20,21,23) |
| InChIKey | VAOIMGHKJULGOI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate?
The IUPAC name of [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate (CID 7695467) is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate.
What is the SMILES notation for [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate?
The canonical SMILES for [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate is C=CCNC(=O)NC(=O)COC(=O)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate?
The InChIKey is VAOIMGHKJULGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O4/c1-2-3-19-17(23)20-15(21)11-24-16(22)10-18-7-12-4-13(8-18)6-14(5-12)9-18/h2,12-14H,1,3-11H2,(H2,19,20,21,23).
What are the key properties of [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate?
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate has a molecular weight of 334.42 g/mol, XLogP of 2.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1-adamantyl)acetate is sourced from PubChem (CID 7695467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).