C24H21NO5 — CID 76955755
16-[2-(oxolan-2-yl)ethyl]-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione (PubChem CID 76955755) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 16-[2-(oxolan-2-yl)ethyl]-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione.
| Compound Name | 16-[2-(oxolan-2-yl)ethyl]-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
|---|---|
| PubChem CID | 76955755 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 16-[2-(oxolan-2-yl)ethyl]-12,18-dioxa-16-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14(19),20-heptaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1c3c(ccc21)OCN(CCC1CCCO1)C3 |
| InChI | InChI=1S/C24H21NO5/c26-21-15-5-1-2-6-16(15)22(27)24-20(21)17-7-8-19-18(23(17)30-24)12-25(13-29-19)10-9-14-4-3-11-28-14/h1-2,5-8,14H,3-4,9-13H2 |
| InChIKey | MAIZOCSHPRPHGI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|