About (6R)-6,8-bis(benzylsulfanyl)octanoic acid
(6R)-6,8-bis(benzylsulfanyl)octanoic acid (PubChem CID 76956685) has the molecular formula C22H28O2S2
and a molecular weight of 388.60 g/mol. Its IUPAC name is (6R)-6,8-bis(benzylsulfanyl)octanoic acid.
Molecular Properties
| Compound Name | (6R)-6,8-bis(benzylsulfanyl)octanoic acid |
| PubChem CID | 76956685 |
| Molecular Formula | C22H28O2S2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (6R)-6,8-bis(benzylsulfanyl)octanoic acid |
| SMILES | O=C(O)CCCC[C@H](CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H28O2S2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,23,24)/t21-/m1/s1 |
| InChIKey | ZYRLHJIMTROTBO-OAQYLSRUSA-N |
| XLogP | 6.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6,8-bis(benzylsulfanyl)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6,8-bis(benzylsulfanyl)octanoic acid?
The IUPAC name of (6R)-6,8-bis(benzylsulfanyl)octanoic acid (CID 76956685) is (6R)-6,8-bis(benzylsulfanyl)octanoic acid.
What is the SMILES notation for (6R)-6,8-bis(benzylsulfanyl)octanoic acid?
The canonical SMILES for (6R)-6,8-bis(benzylsulfanyl)octanoic acid is O=C(O)CCCC[C@H](CCSCc1ccccc1)SCc1ccccc1.
What is the InChIKey of (6R)-6,8-bis(benzylsulfanyl)octanoic acid?
The InChIKey is ZYRLHJIMTROTBO-OAQYLSRUSA-N. The full InChI is InChI=1S/C22H28O2S2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,23,24)/t21-/m1/s1.
What are the key properties of (6R)-6,8-bis(benzylsulfanyl)octanoic acid?
(6R)-6,8-bis(benzylsulfanyl)octanoic acid has a molecular weight of 388.60 g/mol, XLogP of 6.26, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6,8-bis(benzylsulfanyl)octanoic acid is sourced from PubChem (CID 76956685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).