About (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide
(2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide (PubChem CID 76956972) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide |
| PubChem CID | 76956972 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide |
| SMILES | C/C=C/C(=O)N(CC)[C@@H](CC)C(=O)N(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9-10H,7-8H2,1-5H3/b9-6+/t10-/m0/s1 |
| InChIKey | LSAMUAYPDHUBQD-ZKXNXJMVSA-N |
| XLogP | 1.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide?
The IUPAC name of (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide (CID 76956972) is (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide.
What is the SMILES notation for (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide?
The canonical SMILES for (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide is C/C=C/C(=O)N(CC)[C@@H](CC)C(=O)N(C)C.
What is the InChIKey of (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide?
The InChIKey is LSAMUAYPDHUBQD-ZKXNXJMVSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9-10H,7-8H2,1-5H3/b9-6+/t10-/m0/s1.
What are the key properties of (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide?
(2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide has a molecular weight of 226.32 g/mol, XLogP of 1.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide is sourced from PubChem (CID 76956972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).