About potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide
potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide (PubChem CID 76957315) has the molecular formula C11H12F3KN2O3S
and a molecular weight of 348.39 g/mol. Its IUPAC name is potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide |
| PubChem CID | 76957315 |
| Molecular Formula | C11H12F3KN2O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide |
| SMILES | CC(=O)Nc1cc([N-]S(=O)(=O)C(F)(F)F)c(C)cc1C.[K+] |
| InChI | InChI=1S/C11H12F3N2O3S.K/c1-6-4-7(2)10(5-9(6)15-8(3)17)16-20(18,19)11(12,13)14;/h4-5H,1-3H3,(H,15,17);/q-1;+1 |
| InChIKey | QTWDVSMYLOZQBZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide?
The IUPAC name of potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide (CID 76957315) is potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide?
The canonical SMILES for potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide is CC(=O)Nc1cc([N-]S(=O)(=O)C(F)(F)F)c(C)cc1C.[K+].
What is the InChIKey of potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide?
The InChIKey is QTWDVSMYLOZQBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N2O3S.K/c1-6-4-7(2)10(5-9(6)15-8(3)17)16-20(18,19)11(12,13)14;/h4-5H,1-3H3,(H,15,17);/q-1;+1.
What are the key properties of potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide?
potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide has a molecular weight of 348.39 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (5-acetamido-2,4-dimethylphenyl)-(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 76957315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).