About zinc;dioxido(dioxo)chromium;hydroxide
zinc;dioxido(dioxo)chromium;hydroxide (PubChem CID 76957358) has the molecular formula HCrO5Zn-
and a molecular weight of 198.39 g/mol. Its IUPAC name is zinc;dioxido(dioxo)chromium;hydroxide.
Molecular Properties
| Compound Name | zinc;dioxido(dioxo)chromium;hydroxide |
| PubChem CID | 76957358 |
| Molecular Formula | HCrO5Zn- |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 196.85 |
| IUPAC Name | zinc;dioxido(dioxo)chromium;hydroxide |
| SMILES | O=[Cr](=O)([O-])[O-].[OH-].[Zn+2] |
| InChI | InChI=1S/Cr.H2O.4O.Zn/h;1H2;;;;;/q;;;;2*-1;+2/p-1 |
| InChIKey | MLRUKNLKIHFPFH-UHFFFAOYSA-M |
| XLogP | -2.80 |
| TPSA | 110.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;dioxido(dioxo)chromium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;dioxido(dioxo)chromium;hydroxide?
The IUPAC name of zinc;dioxido(dioxo)chromium;hydroxide (CID 76957358) is zinc;dioxido(dioxo)chromium;hydroxide.
What is the SMILES notation for zinc;dioxido(dioxo)chromium;hydroxide?
The canonical SMILES for zinc;dioxido(dioxo)chromium;hydroxide is O=[Cr](=O)([O-])[O-].[OH-].[Zn+2].
What is the InChIKey of zinc;dioxido(dioxo)chromium;hydroxide?
The InChIKey is MLRUKNLKIHFPFH-UHFFFAOYSA-M. The full InChI is InChI=1S/Cr.H2O.4O.Zn/h;1H2;;;;;/q;;;;2*-1;+2/p-1.
What are the key properties of zinc;dioxido(dioxo)chromium;hydroxide?
zinc;dioxido(dioxo)chromium;hydroxide has a molecular weight of 198.39 g/mol, XLogP of -2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;dioxido(dioxo)chromium;hydroxide is sourced from PubChem (CID 76957358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).