C12H18O2 — CID 76958266
(5S)-5-[(2Z,5Z)-octa-2,5-dienyl]oxolan-2-one (PubChem CID 76958266) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (5S)-5-[(2Z,5Z)-octa-2,5-dienyl]oxolan-2-one.
| Compound Name | (5S)-5-[(2Z,5Z)-octa-2,5-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 76958266 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (5S)-5-[(2Z,5Z)-octa-2,5-dienyl]oxolan-2-one |
| SMILES | CC/C=C\C/C=C\C[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h3-4,6-7,11H,2,5,8-10H2,1H3/b4-3-,7-6-/t11-/m1/s1 |
| InChIKey | YNHBLISDDXOUDQ-GRBDCXSLSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|