C10H14Cl6N4O2 — CID 76958583
N-[(1R)-2,2,2-trichloro-1-[4-[(1S)-2,2,2-trichloro-1-formamidoethyl]piperazin-1-yl]ethyl]formamide (PubChem CID 76958583) has the molecular formula C10H14Cl6N4O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[4-[(1S)-2,2,2-trichloro-1-formamidoethyl]piperazin-1-yl]ethyl]formamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[4-[(1S)-2,2,2-trichloro-1-formamidoethyl]piperazin-1-yl]ethyl]formamide |
|---|---|
| PubChem CID | 76958583 |
| Molecular Formula | C10H14Cl6N4O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[4-[(1S)-2,2,2-trichloro-1-formamidoethyl]piperazin-1-yl]ethyl]formamide |
| SMILES | O=CN[C@H](N1CCN([C@H](NC=O)C(Cl)(Cl)Cl)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl6N4O2/c11-9(12,13)7(17-5-21)19-1-2-20(4-3-19)8(18-6-22)10(14,15)16/h5-8H,1-4H2,(H,17,21)(H,18,22)/t7-,8+ |
| InChIKey | RROQIUMZODEXOR-OCAPTIKFSA-N |
| XLogP | 1.49 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|