C12H22O3 — CID 76962172
[(1S,5S)-3,3,5-trimethylcyclohexyl] (2S)-2-hydroxypropanoate (PubChem CID 76962172) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is [(1S,5S)-3,3,5-trimethylcyclohexyl] (2S)-2-hydroxypropanoate.
| Compound Name | [(1S,5S)-3,3,5-trimethylcyclohexyl] (2S)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 76962172 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | [(1S,5S)-3,3,5-trimethylcyclohexyl] (2S)-2-hydroxypropanoate |
| SMILES | C[C@@H]1C[C@H](OC(=O)[C@H](C)O)CC(C)(C)C1 |
| InChI | InChI=1S/C12H22O3/c1-8-5-10(7-12(3,4)6-8)15-11(14)9(2)13/h8-10,13H,5-7H2,1-4H3/t8-,9+,10+/m1/s1 |
| InChIKey | SRJOJNGMYPRTOL-UTLUCORTSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |