C16H18N4O6 — CID 7696267
[2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 2-(2-nitrophenoxy)acetate (PubChem CID 7696267) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7696267 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] 2-(2-nitrophenoxy)acetate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)COC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O6/c1-10-16(11(2)19(3)18-10)17-14(21)8-26-15(22)9-25-13-7-5-4-6-12(13)20(23)24/h4-7H,8-9H2,1-3H3,(H,17,21) |
| InChIKey | VPBFVLAFAJNDIU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|