About 2-amino-3,7-dihydropurine-6-(35S)thione
2-amino-3,7-dihydropurine-6-(35S)thione (PubChem CID 76964418) has the molecular formula C5H5N5S
and a molecular weight of 170.10 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-(35S)thione.
Molecular Properties
| Compound Name | 2-amino-3,7-dihydropurine-6-(35S)thione |
| PubChem CID | 76964418 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 170.10 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-(35S)thione |
| SMILES | Nc1nc(=[35S])c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i11+3 |
| InChIKey | WYWHKKSPHMUBEB-VTVVGURUSA-N |
| XLogP | 0.60 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,7-dihydropurine-6-(35S)thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,7-dihydropurine-6-(35S)thione?
The IUPAC name of 2-amino-3,7-dihydropurine-6-(35S)thione (CID 76964418) is 2-amino-3,7-dihydropurine-6-(35S)thione.
What is the SMILES notation for 2-amino-3,7-dihydropurine-6-(35S)thione?
The canonical SMILES for 2-amino-3,7-dihydropurine-6-(35S)thione is Nc1nc(=[35S])c2[nH]cnc2[nH]1.
What is the InChIKey of 2-amino-3,7-dihydropurine-6-(35S)thione?
The InChIKey is WYWHKKSPHMUBEB-VTVVGURUSA-N. The full InChI is InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i11+3.
What are the key properties of 2-amino-3,7-dihydropurine-6-(35S)thione?
2-amino-3,7-dihydropurine-6-(35S)thione has a molecular weight of 170.10 g/mol, XLogP of 0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,7-dihydropurine-6-(35S)thione is sourced from PubChem (CID 76964418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).