C11H20ClNO5 — CID 76965643
6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-8-ol;dihydrate;hydrochloride (PubChem CID 76965643) has the molecular formula C11H20ClNO5 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-8-ol;dihydrate;hydrochloride.
| Compound Name | 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-8-ol;dihydrate;hydrochloride |
|---|---|
| PubChem CID | 76965643 |
| Molecular Formula | C11H20ClNO5 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-8-ol;dihydrate;hydrochloride |
| SMILES | COc1cc2c(c(O)c1OC)CNCC2.Cl.O.O |
| InChI | InChI=1S/C11H15NO3.ClH.2H2O/c1-14-9-5-7-3-4-12-6-8(7)10(13)11(9)15-2;;;/h5,12-13H,3-4,6H2,1-2H3;1H;2*1H2 |
| InChIKey | LXNMUZBDYFZDDY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|