C11H15BrN2O3 — CID 76966346
5-(2-bromoprop-2-enyl)-5-[(2S)-butan-2-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 76966346) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 5-(2-bromoprop-2-enyl)-5-[(2S)-butan-2-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-bromoprop-2-enyl)-5-[(2S)-butan-2-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 76966346 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5-(2-bromoprop-2-enyl)-5-[(2S)-butan-2-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=C(Br)CC1([C@@H](C)CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H15BrN2O3/c1-4-6(2)11(5-7(3)12)8(15)13-10(17)14-9(11)16/h6H,3-5H2,1-2H3,(H2,13,14,15,16,17)/t6-/m0/s1 |
| InChIKey | FWZMBTIUIQUJFF-LURJTMIESA-N |
| XLogP | 1.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|