C22H28ClNO4 — CID 76966629
[3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxybenzoate;hydrochloride (PubChem CID 76966629) has the molecular formula C22H28ClNO4 and a molecular weight of 405.92 g/mol. Its IUPAC name is [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxybenzoate;hydrochloride.
| Compound Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 76966629 |
| Molecular Formula | C22H28ClNO4 |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 2-hydroxybenzoate;hydrochloride |
| SMILES | CN(C)C[C@H]1CCCC[C@]1(O)c1cccc(OC(=O)c2ccccc2O)c1.Cl |
| InChI | InChI=1S/C22H27NO4.ClH/c1-23(2)15-17-8-5-6-13-22(17,26)16-9-7-10-18(14-16)27-21(25)19-11-3-4-12-20(19)24;/h3-4,7,9-12,14,17,24,26H,5-6,8,13,15H2,1-2H3;1H/t17-,22+;/m1./s1 |
| InChIKey | HSCWGAUDRWJNME-YITVUBHWSA-N |
| XLogP | 3.97 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|