C18H25N4O3+ — CID 7696720
trimethyl-[2-[[2,4,6-trioxo-1-(2-phenylethyl)-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium (PubChem CID 7696720) has the molecular formula C18H25N4O3+ and a molecular weight of 345.42 g/mol. Its IUPAC name is trimethyl-[2-[[2,4,6-trioxo-1-(2-phenylethyl)-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[2,4,6-trioxo-1-(2-phenylethyl)-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
|---|---|
| PubChem CID | 7696720 |
| Molecular Formula | C18H25N4O3+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | trimethyl-[2-[[2,4,6-trioxo-1-(2-phenylethyl)-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
| SMILES | C[N+](C)(C)CC/N=C/C1C(=O)NC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N4O3/c1-22(2,3)12-10-19-13-15-16(23)20-18(25)21(17(15)24)11-9-14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3/p+1/b19-13+ |
| InChIKey | ICIGRMNGGRLFKJ-CPNJWEJPSA-O |
| XLogP | 0.70 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|