About acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine
acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine (PubChem CID 76967353) has the molecular formula C22H45NO2
and a molecular weight of 355.61 g/mol. Its IUPAC name is acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine.
Molecular Properties
| Compound Name | acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine |
| PubChem CID | 76967353 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine |
| SMILES | CC(=O)O.CCCCCCCC/C=C\CCCCCCCCN(C)C |
| InChI | InChI=1S/C20H41N.C2H4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2(3)4/h11-12H,4-10,13-20H2,1-3H3;1H3,(H,3,4)/b12-11-; |
| InChIKey | JEHBDHQRPICJAX-AFEZEDKISA-N |
| XLogP | 6.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine?
The IUPAC name of acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine (CID 76967353) is acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine.
What is the SMILES notation for acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine?
The canonical SMILES for acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine is CC(=O)O.CCCCCCCC/C=C\CCCCCCCCN(C)C.
What is the InChIKey of acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine?
The InChIKey is JEHBDHQRPICJAX-AFEZEDKISA-N. The full InChI is InChI=1S/C20H41N.C2H4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2(3)4/h11-12H,4-10,13-20H2,1-3H3;1H3,(H,3,4)/b12-11-;.
What are the key properties of acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine?
acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine has a molecular weight of 355.61 g/mol, XLogP of 6.68, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(Z)-N,N-dimethyloctadec-9-en-1-amine is sourced from PubChem (CID 76967353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).