C20H32N2O6S — CID 76968318
bis(4-[(2S)-2-(methylamino)propyl]phenol);sulfuric acid (PubChem CID 76968318) has the molecular formula C20H32N2O6S and a molecular weight of 428.55 g/mol. Its IUPAC name is bis(4-[(2S)-2-(methylamino)propyl]phenol);sulfuric acid.
| Compound Name | bis(4-[(2S)-2-(methylamino)propyl]phenol);sulfuric acid |
|---|---|
| PubChem CID | 76968318 |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | bis(4-[(2S)-2-(methylamino)propyl]phenol);sulfuric acid |
| SMILES | CN[C@@H](C)Cc1ccc(O)cc1.CN[C@@H](C)Cc1ccc(O)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H15NO.H2O4S/c2*1-8(11-2)7-9-3-5-10(12)6-4-9;1-5(2,3)4/h2*3-6,8,11-12H,7H2,1-2H3;(H2,1,2,3,4)/t2*8-;/m00./s1 |
| InChIKey | WUORSSYNZWHFQY-QXGOIDDHSA-N |
| XLogP | 2.43 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|