C21H24ClN — CID 76968505
(1S,8S)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaene;hydrochloride (PubChem CID 76968505) has the molecular formula C21H24ClN and a molecular weight of 325.88 g/mol. Its IUPAC name is (1S,8S)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaene;hydrochloride.
| Compound Name | (1S,8S)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaene;hydrochloride |
|---|---|
| PubChem CID | 76968505 |
| Molecular Formula | C21H24ClN |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (1S,8S)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaene;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CCc1cccc3c1[C@H]2CN1CCCC[C@@H]31 |
| InChI | InChI=1S/C21H23N.ClH/c1-2-8-17-15(6-1)11-12-16-7-5-9-18-20-10-3-4-13-22(20)14-19(17)21(16)18;/h1-2,5-9,19-20H,3-4,10-14H2;1H/t19-,20-;/m0./s1 |
| InChIKey | LOSFVNFVCCXCEN-FKLPMGAJSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |