About 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate
2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate (PubChem CID 76969851) has the molecular formula C25H48N2O4
and a molecular weight of 440.67 g/mol. Its IUPAC name is 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate.
Molecular Properties
| Compound Name | 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate |
| PubChem CID | 76969851 |
| Molecular Formula | C25H48N2O4 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.36 |
| IUPAC Name | 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C25H48N2O4/c1-4-5-6-13-17-23(28)18-14-11-9-7-8-10-12-15-19-24(29)26-20-16-21-27(2,3)22-25(30)31/h11,14,23,28H,4-10,12-13,15-22H2,1-3H3,(H-,26,29,30,31)/b14-11-/t23-/m1/s1 |
| InChIKey | ZMXWTYDZWPGTOM-LKAWRWRFSA-N |
| XLogP | 3.33 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate?
The IUPAC name of 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate (CID 76969851) is 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate.
What is the SMILES notation for 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate?
The canonical SMILES for 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate is CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-].
What is the InChIKey of 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate?
The InChIKey is ZMXWTYDZWPGTOM-LKAWRWRFSA-N. The full InChI is InChI=1S/C25H48N2O4/c1-4-5-6-13-17-23(28)18-14-11-9-7-8-10-12-15-19-24(29)26-20-16-21-27(2,3)22-25(30)31/h11,14,23,28H,4-10,12-13,15-22H2,1-3H3,(H-,26,29,30,31)/b14-11-/t23-/m1/s1.
What are the key properties of 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate?
2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate has a molecular weight of 440.67 g/mol, XLogP of 3.33, 21 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]propyl-dimethylazaniumyl]acetate is sourced from PubChem (CID 76969851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).