C19H23I2NO2 — CID 76970364
4-[(1S,2R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]propyl]-2,6-diiodophenol (PubChem CID 76970364) has the molecular formula C19H23I2NO2 and a molecular weight of 551.21 g/mol. Its IUPAC name is 4-[(1S,2R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]propyl]-2,6-diiodophenol.
| Compound Name | 4-[(1S,2R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]propyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 76970364 |
| Molecular Formula | C19H23I2NO2 |
| Molecular Weight | 551.21 g/mol |
| Exact Mass | 550.98 |
| IUPAC Name | 4-[(1S,2R)-1-hydroxy-2-[[(2R)-4-phenylbutan-2-yl]amino]propyl]-2,6-diiodophenol |
| SMILES | C[C@H](CCc1ccccc1)N[C@H](C)[C@@H](O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C19H23I2NO2/c1-12(8-9-14-6-4-3-5-7-14)22-13(2)18(23)15-10-16(20)19(24)17(21)11-15/h3-7,10-13,18,22-24H,8-9H2,1-2H3/t12-,13-,18-/m1/s1 |
| InChIKey | RFIXURDMUINBMD-SNUQEOBHSA-N |
| XLogP | 4.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|