About disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate
disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate (PubChem CID 76971450) has the molecular formula C9H10N4Na2O4
and a molecular weight of 284.18 g/mol. Its IUPAC name is disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate.
Molecular Properties
| Compound Name | disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate |
| PubChem CID | 76971450 |
| Molecular Formula | C9H10N4Na2O4 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate |
| SMILES | CC(=O)[O-].Cn1cnc2c1c([O-])nc(=O)n2C.[Na+].[Na+] |
| InChI | InChI=1S/C7H8N4O2.C2H4O2.2Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-2(3)4;;/h3H,1-2H3,(H,9,12,13);1H3,(H,3,4);;/q;;2*+1/p-2 |
| InChIKey | BQWXDQUPYCHWGB-UHFFFAOYSA-L |
| XLogP | -8.50 |
| TPSA | 115.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | -8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate?
The IUPAC name of disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate (CID 76971450) is disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate.
What is the SMILES notation for disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate?
The canonical SMILES for disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate is CC(=O)[O-].Cn1cnc2c1c([O-])nc(=O)n2C.[Na+].[Na+].
What is the InChIKey of disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate?
The InChIKey is BQWXDQUPYCHWGB-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8N4O2.C2H4O2.2Na/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;1-2(3)4;;/h3H,1-2H3,(H,9,12,13);1H3,(H,3,4);;/q;;2*+1/p-2.
What are the key properties of disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate?
disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate has a molecular weight of 284.18 g/mol, XLogP of -8.50, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3,7-dimethyl-2-oxopurin-6-olate;acetate is sourced from PubChem (CID 76971450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).