C21H27NOS — CID 76971717
(1S,2R)-1-(2,3-dihydro-1-benzothiophen-5-yl)-2-(4-phenylbutylamino)propan-1-ol (PubChem CID 76971717) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is (1S,2R)-1-(2,3-dihydro-1-benzothiophen-5-yl)-2-(4-phenylbutylamino)propan-1-ol.
| Compound Name | (1S,2R)-1-(2,3-dihydro-1-benzothiophen-5-yl)-2-(4-phenylbutylamino)propan-1-ol |
|---|---|
| PubChem CID | 76971717 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (1S,2R)-1-(2,3-dihydro-1-benzothiophen-5-yl)-2-(4-phenylbutylamino)propan-1-ol |
| SMILES | C[C@@H](NCCCCc1ccccc1)[C@@H](O)c1ccc2c(c1)CCS2 |
| InChI | InChI=1S/C21H27NOS/c1-16(22-13-6-5-9-17-7-3-2-4-8-17)21(23)19-10-11-20-18(15-19)12-14-24-20/h2-4,7-8,10-11,15-16,21-23H,5-6,9,12-14H2,1H3/t16-,21-/m1/s1 |
| InChIKey | FJLRGFADCXTJNV-IIBYNOLFSA-N |
| XLogP | 4.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|