C15H24O8 — CID 76973343
tetraethyl (1,3-13C2)propane-1,1,3,3-tetracarboxylate (PubChem CID 76973343) has the molecular formula C15H24O8 and a molecular weight of 338.30 g/mol. Its IUPAC name is tetraethyl (1,3-13C2)propane-1,1,3,3-tetracarboxylate.
| Compound Name | tetraethyl (1,3-13C2)propane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 76973343 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tetraethyl (1,3-13C2)propane-1,1,3,3-tetracarboxylate |
| SMILES | CCO[13C](=O)[13CH](C[13CH]([13C](=O)OCC)[13C](=O)OCC)[13C](=O)OCC |
| InChI | InChI=1S/C15H24O8/c1-5-20-12(16)10(13(17)21-6-2)9-11(14(18)22-7-3)15(19)23-8-4/h10-11H,5-9H2,1-4H3/i10+1,11+1,12+1,13+1,14+1,15+1 |
| InChIKey | KSXISDYTRDNZLB-RWFIAFQRSA-N |
| XLogP | 0.86 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|