C11H15NO2 — CID 76973344
1-(cyclopent-3-en-1-ylmethyl)(2,3,5,6-13C4)azinane-2,6-dione (PubChem CID 76973344) has the molecular formula C11H15NO2 and a molecular weight of 197.22 g/mol. Its IUPAC name is 1-(cyclopent-3-en-1-ylmethyl)(2,3,5,6-13C4)azinane-2,6-dione.
| Compound Name | 1-(cyclopent-3-en-1-ylmethyl)(2,3,5,6-13C4)azinane-2,6-dione |
|---|---|
| PubChem CID | 76973344 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(cyclopent-3-en-1-ylmethyl)(2,3,5,6-13C4)azinane-2,6-dione |
| SMILES | O=[13C]1[13CH2]C[13CH2][13C](=O)N1CC1CC=CC1 |
| InChI | InChI=1S/C11H15NO2/c13-10-6-3-7-11(14)12(10)8-9-4-1-2-5-9/h1-2,9H,3-8H2/i6+1,7+1,10+1,11+1 |
| InChIKey | UGXJEKOHANPBQO-JELBLWPASA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|