C19H28O2 — CID 76973624
(1S,10R,13S,17S)-1,16,16,17-tetradeuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 76973624) has the molecular formula C19H28O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (1S,10R,13S,17S)-1,16,16,17-tetradeuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,10R,13S,17S)-1,16,16,17-tetradeuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 76973624 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (1S,10R,13S,17S)-1,16,16,17-tetradeuterio-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [2H][C@H]1CC(=O)C=C2CCC3C(CC[C@@]4(C)C3CC([2H])([2H])[C@]4([2H])O)[C@]21C |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14?,15?,16?,17-,18-,19-/m0/s1/i6D2,9D,17D/t9-,14?,15?,16?,17-,18-,19- |
| InChIKey | MUMGGOZAMZWBJJ-SAZOEWSOSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |