C6H5F — CID 76973692
fluoro(1,2,3,4,5,6-13C6)cyclohexatriene (PubChem CID 76973692) has the molecular formula C6H5F and a molecular weight of 102.06 g/mol. Its IUPAC name is fluoro(1,2,3,4,5,6-13C6)cyclohexatriene.
| Compound Name | fluoro(1,2,3,4,5,6-13C6)cyclohexatriene |
|---|---|
| PubChem CID | 76973692 |
| Molecular Formula | C6H5F |
| Molecular Weight | 102.06 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | fluoro(1,2,3,4,5,6-13C6)cyclohexatriene |
| SMILES | F[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C6H5F/c7-6-4-2-1-3-5-6/h1-5H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | PYLWMHQQBFSUBP-IDEBNGHGSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.06 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |