C15H14O3 — CID 76974283
3,3,3-trideuterio-2-(3-phenoxyphenyl)(313C)propanoic acid (PubChem CID 76974283) has the molecular formula C15H14O3 and a molecular weight of 246.28 g/mol. Its IUPAC name is 3,3,3-trideuterio-2-(3-phenoxyphenyl)(313C)propanoic acid.
| Compound Name | 3,3,3-trideuterio-2-(3-phenoxyphenyl)(313C)propanoic acid |
|---|---|
| PubChem CID | 76974283 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3,3,3-trideuterio-2-(3-phenoxyphenyl)(313C)propanoic acid |
| SMILES | [2H][13C]([2H])([2H])C(C(=O)O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17)/i1+1D3 |
| InChIKey | RDJGLLICXDHJDY-KQORAOOSSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |