4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid

C10H12N2O3 — CID 76974894

IUPAC4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid
SMILESCc1cc(=O)n(CC=CC(=O)O)c(C)n1
InChIInChI=1S/C10H12N2O3/c1-7-6-9(13)12(8(2)11-7)5-3-4-10(14)15/h3-4,6H,5H2,1-2H3,(H,14,15)
InChIKeyQWFGTPLOVCITTK-UHFFFAOYSA-N
MW208.22 g/mol
LogP0.50
Rot. Bonds3

About 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid

4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid (PubChem CID 76974894) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid.

Molecular Properties

Compound Name4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid
PubChem CID76974894
Molecular FormulaC10H12N2O3
Molecular Weight208.22 g/mol
Exact Mass208.08
IUPAC Name4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid
SMILESCc1cc(=O)n(CC=CC(=O)O)c(C)n1
InChIInChI=1S/C10H12N2O3/c1-7-6-9(13)12(8(2)11-7)5-3-4-10(14)15/h3-4,6H,5H2,1-2H3,(H,14,15)
InChIKeyQWFGTPLOVCITTK-UHFFFAOYSA-N
XLogP0.50
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.22
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid?
The IUPAC name of 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid (CID 76974894) is 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid.
What is the SMILES notation for 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid?
The canonical SMILES for 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid is Cc1cc(=O)n(CC=CC(=O)O)c(C)n1.
What is the InChIKey of 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid?
The InChIKey is QWFGTPLOVCITTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-7-6-9(13)12(8(2)11-7)5-3-4-10(14)15/h3-4,6H,5H2,1-2H3,(H,14,15).
What are the key properties of 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid?
4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid has a molecular weight of 208.22 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-6-oxopyrimidin-1-yl)but-2-enoic acid is sourced from PubChem (CID 76974894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).