C12H12ClN5O2S — CID 76975714
2-chloro-6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 76975714) has the molecular formula C12H12ClN5O2S and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-chloro-6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-chloro-6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 76975714 |
| Molecular Formula | C12H12ClN5O2S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-chloro-6-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1c(Cl)cccc1Sc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C12H12ClN5O2S/c13-7-2-1-3-8(9(7)10(14)17-20)21-12-16-15-11(19)18(12)6-4-5-6/h1-3,6,20H,4-5H2,(H2,14,17)(H,15,19) |
| InChIKey | UIKJJOAXRVAIEB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|