C11H19F3N4O2 — CID 76979528
N'-hydroxy-2,2-dimethyl-3-oxo-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide (PubChem CID 76979528) has the molecular formula C11H19F3N4O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-3-oxo-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-3-oxo-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 76979528 |
| Molecular Formula | C11H19F3N4O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-3-oxo-3-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propanimidamide |
| SMILES | CC(C)(C(=O)N1CCN(CC(F)(F)F)CC1)C(N)=NO |
| InChI | InChI=1S/C11H19F3N4O2/c1-10(2,8(15)16-20)9(19)18-5-3-17(4-6-18)7-11(12,13)14/h20H,3-7H2,1-2H3,(H2,15,16) |
| InChIKey | QINLQLPRZKSRJE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|