C10H14ClN3O2 — CID 76981406
2-chloro-N'-hydroxy-4-[2-hydroxyethyl(methyl)amino]benzenecarboximidamide (PubChem CID 76981406) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-4-[2-hydroxyethyl(methyl)amino]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-4-[2-hydroxyethyl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 76981406 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-chloro-N'-hydroxy-4-[2-hydroxyethyl(methyl)amino]benzenecarboximidamide |
| SMILES | CN(CCO)c1ccc(C(N)=NO)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClN3O2/c1-14(4-5-15)7-2-3-8(9(11)6-7)10(12)13-16/h2-3,6,15-16H,4-5H2,1H3,(H2,12,13) |
| InChIKey | HGZUESVMVZBKEM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|