C13H17N3O3 — CID 76982116
N-[2-(N'-hydroxycarbamimidoyl)phenyl]oxane-3-carboxamide (PubChem CID 76982116) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[2-(N'-hydroxycarbamimidoyl)phenyl]oxane-3-carboxamide.
| Compound Name | N-[2-(N'-hydroxycarbamimidoyl)phenyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 76982116 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(N'-hydroxycarbamimidoyl)phenyl]oxane-3-carboxamide |
| SMILES | NC(=NO)c1ccccc1NC(=O)C1CCCOC1 |
| InChI | InChI=1S/C13H17N3O3/c14-12(16-18)10-5-1-2-6-11(10)15-13(17)9-4-3-7-19-8-9/h1-2,5-6,9,18H,3-4,7-8H2,(H2,14,16)(H,15,17) |
| InChIKey | KLXWMGZTPVSOSV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|