C14H13ClN2OS — CID 76984290
3-chloro-N'-hydroxy-4-(3-methylphenyl)sulfanylbenzenecarboximidamide (PubChem CID 76984290) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-(3-methylphenyl)sulfanylbenzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-(3-methylphenyl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 76984290 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-(3-methylphenyl)sulfanylbenzenecarboximidamide |
| SMILES | Cc1cccc(Sc2ccc(C(N)=NO)cc2Cl)c1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-9-3-2-4-11(7-9)19-13-6-5-10(8-12(13)15)14(16)17-18/h2-8,18H,1H3,(H2,16,17) |
| InChIKey | DWNCRIGFKGBZBC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|