C10H10ClN5OS — CID 76984922
4-chloro-N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 76984922) has the molecular formula C10H10ClN5OS and a molecular weight of 283.74 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 76984922 |
| Molecular Formula | C10H10ClN5OS |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cc1nc(Sc2cc(Cl)ccc2C(N)=NO)n[nH]1 |
| InChI | InChI=1S/C10H10ClN5OS/c1-5-13-10(15-14-5)18-8-4-6(11)2-3-7(8)9(12)16-17/h2-4,17H,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | AUGCNYJUFDJTOI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|