C15H25ClN4O — CID 76985058
4-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 76985058) has the molecular formula C15H25ClN4O and a molecular weight of 312.85 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 76985058 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | CC(C)CN(CCN(C)C)c1cc(Cl)ccc1C(N)=NO |
| InChI | InChI=1S/C15H25ClN4O/c1-11(2)10-20(8-7-19(3)4)14-9-12(16)5-6-13(14)15(17)18-21/h5-6,9,11,21H,7-8,10H2,1-4H3,(H2,17,18) |
| InChIKey | UIXYHNDMNAMDKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|