C14H21N3O — CID 76986044
N-tert-butyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-c]pyrazol-3-amine (PubChem CID 76986044) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-tert-butyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-c]pyrazol-3-amine.
| Compound Name | N-tert-butyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 76986044 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-tert-butyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-c]pyrazol-3-amine |
| SMILES | CC(C)(C)NC1NNC2c3ccccc3OCC12 |
| InChI | InChI=1S/C14H21N3O/c1-14(2,3)15-13-10-8-18-11-7-5-4-6-9(11)12(10)16-17-13/h4-7,10,12-13,15-17H,8H2,1-3H3 |
| InChIKey | GFDVTQICQPACMR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |