C16H22N2O2S — CID 76986837
3-[2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76986837) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-[2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76986837 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-[2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccsc1CN1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C16H22N2O2S/c19-16(20)4-3-13-6-10-21-15(13)12-17-9-5-14(11-17)18-7-1-2-8-18/h3-4,6,10,14H,1-2,5,7-9,11-12H2,(H,19,20) |
| InChIKey | YKMUCOBZMCCCAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|