C12H18N2O4 — CID 76991584
4-(2-carbamoylpiperidin-1-yl)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76991584) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(2-carbamoylpiperidin-1-yl)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(2-carbamoylpiperidin-1-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76991584 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-(2-carbamoylpiperidin-1-yl)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)N1CCCCC1C(N)=O |
| InChI | InChI=1S/C12H18N2O4/c1-7(8(2)12(17)18)11(16)14-6-4-3-5-9(14)10(13)15/h9H,3-6H2,1-2H3,(H2,13,15)(H,17,18) |
| InChIKey | MSFVEKXOUKTOGS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|