C11H14N4O4 — CID 76991902
2,3-dimethyl-4-[(1-methylpyrazol-4-yl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 76991902) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(1-methylpyrazol-4-yl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[(1-methylpyrazol-4-yl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76991902 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2,3-dimethyl-4-[(1-methylpyrazol-4-yl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C11H14N4O4/c1-6(7(2)10(17)18)9(16)14-11(19)13-8-4-12-15(3)5-8/h4-5H,1-3H3,(H,17,18)(H2,13,14,16,19) |
| InChIKey | MQTLZUJHNVACLG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|