C13H17N3O4S — CID 76992035
4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992035) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992035 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)carbamoylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CCc1nc(NC(=O)NC(=O)C(C)=C(C)C(=O)O)sc1C |
| InChI | InChI=1S/C13H17N3O4S/c1-5-9-8(4)21-13(14-9)16-12(20)15-10(17)6(2)7(3)11(18)19/h5H2,1-4H3,(H,18,19)(H2,14,15,16,17,20) |
| InChIKey | DESPYCIVWPDYGG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|