C11H15N5O4 — CID 76992290
2,3-dimethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 76992290) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2,3-dimethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992290 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2,3-dimethyl-4-[(4-methyl-1,2,4-triazol-3-yl)methylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NCc1nncn1C |
| InChI | InChI=1S/C11H15N5O4/c1-6(7(2)10(18)19)9(17)14-11(20)12-4-8-15-13-5-16(8)3/h5H,4H2,1-3H3,(H,18,19)(H2,12,14,17,20) |
| InChIKey | VMPRSVIPRSDMQI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|