C15H21N3O3 — CID 7699310
2-[(Z)-(4-ethylphenyl)methylideneamino]oxy-N-(propylcarbamoyl)acetamide (PubChem CID 7699310) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(Z)-(4-ethylphenyl)methylideneamino]oxy-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-[(Z)-(4-ethylphenyl)methylideneamino]oxy-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7699310 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[(Z)-(4-ethylphenyl)methylideneamino]oxy-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)CO/N=C\c1ccc(CC)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-9-16-15(20)18-14(19)11-21-17-10-13-7-5-12(4-2)6-8-13/h5-8,10H,3-4,9,11H2,1-2H3,(H2,16,18,19,20)/b17-10- |
| InChIKey | NCIZQSBCJFAVMY-YVLHZVERSA-N |
| XLogP | 1.84 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|